Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Galanthamine is a potent acetylcholinesterase (AChE) inhibitor with an IC50 of 500 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12483 |
|---|---|
| Formula | C17H21NO3 |
| Molecular Weight | 287.35 |
| CAS Number | 357-70-0 |
| SMILES | O[C@@H]1C[C@@H]2OC3=C4C(CN(C)CC[C@]42C=C1)=CC=C3OC |
| Synonyms | Galantamine |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 99 mg/mL (344.52 mM) | |
| Water | 56 mg/mL (194.88 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 34.8 mL | 174 mL | 348.01 mL |
| 0.5 mM | 6.96 mL | 34.8 mL | 69.6 mL |
| 1 mM | 3.48 mL | 17.4 mL | 34.8 mL |
| 5 mM | 0.7 mL | 3.48 mL | 6.96 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
