Signaling Pathway
COX-2 inhibitor
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Gallic acid is a trihydroxybenzoic acid found in many plants as either the free acid or in the esterified form of gallotannins and ellagitannins. Gallic acid is an antioxidant which can inhibit both COX-2. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12055 |
|---|---|
| Formula | C7H6O5 |
| Molecular Weight | 170.1 |
| CAS Number | 149-91-7 |
| SMILES | OC1=C(O)C(O)=CC(C(O)=O)=C1 |
| Synonyms | NSC 674319, NSC 20103 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 32 mg/mL (188.09 mM) | |
| Water | 7 mg/mL (41.14 mM) | ||
| Ethanol | 32 mg/mL (188.09 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 58.79 mL | 293.94 mL | 587.89 mL |
| 0.5 mM | 11.76 mL | 58.79 mL | 117.58 mL |
| 1 mM | 5.88 mL | 29.39 mL | 58.79 mL |
| 5 mM | 1.18 mL | 5.88 mL | 11.76 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
