Loading distributor info...
| Description | GK921 is a transglutaminase 2 (TGase) inhibitor with an IC50 of 7.71 μM for human recombinant TGase 2. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A21785 |
|---|---|
| Formula | C21H20N4O |
| Molecular Weight | 344.41 |
| CAS Number | 1025015-40-0 |
| SMILES | C12=NC=CC=C1N=C(OCCN3CCCC3)C(C#CC4=CC=CC=C4)=N2 |
| Synonyms | GK 921, GK-921 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 31 mg/mL (90 mM) | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.04 mL | 145.18 mL | 290.35 mL |
| 0.5 mM | 5.81 mL | 29.04 mL | 58.07 mL |
| 1 mM | 2.9 mL | 14.52 mL | 29.04 mL |
| 5 mM | 0.58 mL | 2.9 mL | 5.81 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
