Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | GSK2837808A is a potent and selective lactate dehydrogenase A (LDHA) inhibitor with IC50s of 1.9 and 14 nM for LDHA and LDHB, respectively. |
|---|
| Catalog Num | A20321 |
|---|---|
| Formula | C31H25F2N5O7S |
| Molecular Weight | 649.62 |
| CAS Number | 1445879-21-9 |
| SMILES | O=C(O)C1=CC(OC2=CC(F)=CC(F)=C2)=CC(NC3=C(S(=O)(NC4CC4)=O)C=NC5=CC(C6=CN=C(OC)N=C6OC)=CC=C35)=C1 |
| Synonyms | GSK 2837808A, GSK-2837808A |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 93 mg/mL (143.15 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 15.39 mL | 76.97 mL | 153.94 mL |
| 0.5 mM | 3.08 mL | 15.39 mL | 30.79 mL |
| 1 mM | 1.54 mL | 7.7 mL | 15.39 mL |
| 5 mM | 0.31 mL | 1.54 mL | 3.08 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
