Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Hexachlorophene is a potent KCNQ1/KCNE1 potassium channel activator with EC50 of 4.61 ?? 1.29 uM; also is an inhibitor of Wnt/beta-catenin signaling. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16217 |
|---|---|
| Formula | C13H6Cl6O2 |
| Molecular Weight | 406.9 |
| CAS Number | 70-30-4 |
| SMILES | C1=C(C(=C(C(=C1Cl)Cl)CC2=C(C(=CC(=C2Cl)Cl)Cl)O)O)Cl |
| Synonyms | Hexachlorofen |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 71 mg/mL (174.48 mM) | |
| Water | Insoluble | ||
| Ethanol | 71 mg/mL (174.48 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.58 mL | 122.88 mL | 245.76 mL |
| 0.5 mM | 4.92 mL | 24.58 mL | 49.15 mL |
| 1 mM | 2.46 mL | 12.29 mL | 24.58 mL |
| 5 mM | 0.49 mL | 2.46 mL | 4.92 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
