Loading distributor info...
| Description | Himbosine is an alkaloid derived from the bark of the plant H. baccata. It exhibits potential biological activities, which may be valuable in pharmacological research. Further studies are necessary to elucidate its mechanisms of action and potential therapeutic applications in various disease models. |
|---|
| Catalog Num | B20814 |
|---|---|
| Formula | C35H41NO10 |
| Molecular Weight | 635.70 |
| CAS Number | 15448-14-3 |
| SMILES | CC(O[C@]1([C@]2([H])CC3)C([C@@]([C@@](CC[C@@H]4OC(C)=O)([H])[C@]([C@H]4OC(C5=CC=CC=C5)=O)([H])[C@@H]6OC(C)=O)(N([C@H]3C)[C@]2([H])C7)C7C1)=C6C(OC)=O)=O |
| Synonyms | (+)-Himbosine |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
