HLCL-61 hydrochloride is a potent and selective PRMT5 inhibitor for the treatment of acute myeloid leukemia.
Loading distributor info...
| Description | HLCL-61 hydrochloride is a potent and selective PRMT5 inhibitor for the treatment of acute myeloid leukemia. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15870 |
|---|---|
| Formula | C23H24N2O.HCl |
| Molecular Weight | 380.91 |
| CAS Number | 1158279-20-9 |
| SMILES | COC1=CC=CC=C1CNCC2=CC3=C(C=C2)N(CC)C4=C3C=CC=C4.[H]Cl |
| Synonyms | HLCL-61 hydrochloride |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 65 mg/mL (170.64 mM) | |
| Water | Insoluble | ||
| Ethanol | 65 mg/mL (170.64 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.25 mL | 131.26 mL | 262.53 mL |
| 0.5 mM | 5.25 mL | 26.25 mL | 52.51 mL |
| 1 mM | 2.63 mL | 13.13 mL | 26.25 mL |
| 5 mM | 0.53 mL | 2.63 mL | 5.25 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
