Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | IACS-10759 is a potent inhibitor of complex I of oxidative phosphorylation (OXPHOS). |
|---|
| Catalog Num | A12006 |
|---|---|
| Formula | C25H25F3N6O4S |
| Molecular Weight | 562.57 |
| CAS Number | 1570496-34-2 |
| SMILES | FC(F)(F)OC1=CC=C(C2=NOC(C3=NN(CC4=CC=CC(N5CCC(S(=O)(C)=O)CC5)=C4)C(C)=N3)=N2)C=C1 |
| Synonyms | IACS-10759, IACS 10759, IACS10759, IACS010759, IACS 010759 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 24 mg/mL (42.66 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.78 mL | 88.88 mL | 177.76 mL |
| 0.5 mM | 3.56 mL | 17.78 mL | 35.55 mL |
| 1 mM | 1.78 mL | 8.89 mL | 17.78 mL |
| 5 mM | 0.36 mL | 1.78 mL | 3.56 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
