Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Iberdomide (CC-220) is a cereblon (CRBN) modulator with an IC50 of 60 nM. |
|---|
| Catalog Num | A20373 |
|---|---|
| Formula | C25H27N3O5 |
| Molecular Weight | 449.5 |
| CAS Number | 1323403-33-3 |
| SMILES | O=C([C@@H](N(CC1=C2C=CC=C1OCC3=CC=C(CN4CCOCC4)C=C3)C2=O)CC5)NC5=O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 77 mg/mL (171.3 mM) | |
| Water | Insoluble | ||
| Ethanol | 6 mg/mL (13.35 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.25 mL | 111.23 mL | 222.47 mL |
| 0.5 mM | 4.45 mL | 22.25 mL | 44.49 mL |
| 1 mM | 2.22 mL | 11.12 mL | 22.25 mL |
| 5 mM | 0.44 mL | 2.22 mL | 4.45 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
