Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | iCRT 14 is a novel potent inhibitor of beta-catenin-responsive transcription (CRT) (IC50 = 40.3 nM in assays of Wnt pathway activity). |
|---|
| Catalog Num | A16218 |
|---|---|
| Formula | C21H17N3O2S |
| Molecular Weight | 375.44 |
| CAS Number | 677331-12-3 |
| SMILES | CC1=CC(=C(N1C2=CN=CC=C2)C)C=C3C(=O)N(C(=O)S3)C4=CC=CC=C4 |
| Synonyms | iCRT14, iCRT-14 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 35 mg/mL (93.22 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.64 mL | 133.18 mL | 266.35 mL |
| 0.5 mM | 5.33 mL | 26.64 mL | 53.27 mL |
| 1 mM | 2.66 mL | 13.32 mL | 26.64 mL |
| 5 mM | 0.53 mL | 2.66 mL | 5.33 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
