Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | IQ-1 is a cell-permeable tetrahydroisoquinolinylidene compound that modulates Wnt/beta-catenin signaling. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16064 |
|---|---|
| Formula | C21H22N4O2 |
| Molecular Weight | 362.4 |
| CAS Number | 331001-62-8 |
| SMILES | CC(N/1)(C)CC2=CC=CC=C2C1=C(\N=N\C3=CC=C(C(C)=O)C=C3)C(N)=O |
| Synonyms | IQ1 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 68 mg/mL (187.62 mM) | |
| Water | Insoluble | ||
| Ethanol | 7 mg/mL (19.31 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.59 mL | 137.97 mL | 275.94 mL |
| 0.5 mM | 5.52 mL | 27.59 mL | 55.19 mL |
| 1 mM | 2.76 mL | 13.8 mL | 27.59 mL |
| 5 mM | 0.55 mL | 2.76 mL | 5.52 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
