Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | JPH203 is a potent and selective L-type amino acid transporter 1 (LAT-1) inhibitor. |
|---|
| Catalog Num | A20445 |
|---|---|
| Formula | C23H19Cl2N3O4 |
| Molecular Weight | 472.32 |
| CAS Number | 1037592-40-7 |
| SMILES | N[C@@H](CC1=CC(Cl)=C(C(Cl)=C1)OCC2=C(OC(C3=CC=CC=C3)=N4)C4=CC(N)=C2)C(O)=O |
| Synonyms | KYT-0353 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 0.01 mg/mL (0.02 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.17 mL | 105.86 mL | 211.72 mL |
| 0.5 mM | 4.23 mL | 21.17 mL | 42.34 mL |
| 1 mM | 2.12 mL | 10.59 mL | 21.17 mL |
| 5 mM | 0.42 mL | 2.12 mL | 4.23 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
