Loading distributor info...
| Description | KKL-10 is a small-molecule ribosome rescue inhibitor with broad-spectrum antimicrobial activity against bacteria. |
|---|
| Catalog Num | A19916 |
|---|---|
| Formula | C14H10BrN3O2S |
| Molecular Weight | 364.22 |
| CAS Number | 952849-76-2 |
| SMILES | O=C(C1=CC=C(Br)S1)NC2=NN=C(C3=CC=C(C)C=C3)O2 |
| Synonyms | KKL10, KKL 10 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 3 mg/mL (8.23 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.46 mL | 137.28 mL | 274.56 mL |
| 0.5 mM | 5.49 mL | 27.46 mL | 54.91 mL |
| 1 mM | 2.75 mL | 13.73 mL | 27.46 mL |
| 5 mM | 0.55 mL | 2.75 mL | 5.49 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
