Signaling Pathway
Wnt/beta-catenin modulator
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | KY1220 is a compound that destabilizes both β-catenin and Ras, via targeting the Wnt/β-catenin pathway; with an IC50 of 2.1 μM in HEK293 reporter cells. |
|---|
| Catalog Num | A20284 |
|---|---|
| Formula | C14H10N4O3S |
| Molecular Weight | 314.32 |
| CAS Number | 292168-79-7 |
| SMILES | O=C(/C(N1)=C/C2=CC=CN2C3=CC=C([N+]([O-])=O)C=C3)NC1=S |
| Synonyms | KY 1220, KY-1220 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 59 mg/mL (187.7 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.81 mL | 159.07 mL | 318.15 mL |
| 0.5 mM | 6.36 mL | 31.81 mL | 63.63 mL |
| 1 mM | 3.18 mL | 15.91 mL | 31.81 mL |
| 5 mM | 0.64 mL | 3.18 mL | 6.36 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
