Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | L189 is a novel human DNA ligase inhibitor, inhibits hLigI/III/IV with IC50 of 5/9/5 μM. |
|---|
| Catalog Num | A15790 |
|---|---|
| Formula | C11H10N4OS |
| Molecular Weight | 246.29 |
| CAS Number | 64232-83-3 |
| SMILES | C1=CC=C(C=C1)C=NC2=C(NC(=S)NC2=O)N |
| Synonyms | L-189, L 189 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 45 mg/mL (182.71 mM) | |
| Water | <1 mg/mL | ||
| Ethanol | <1 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 40.6 mL | 203.01 mL | 406.03 mL |
| 0.5 mM | 8.12 mL | 40.6 mL | 81.21 mL |
| 1 mM | 4.06 mL | 20.3 mL | 40.6 mL |
| 5 mM | 0.81 mL | 4.06 mL | 8.12 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
