Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Lactose is milk sugar. It is a disaccharide composed of one galactose and one glucose molecule. In the pharmaceutical industry, lactose is used to help form tablets because it has excellent compressibility properties. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17807 |
|---|---|
| Formula | C12H22O11 |
| Molecular Weight | 342.3 |
| CAS Number | 63-42-3 |
| SMILES | O=C[C@@H]([C@H]([C@@H]([C@@H](CO)O)O[C@H]1[C@@H]([C@H]([C@H]([C@@H](CO)O1)O)O)O)O)O |
| Synonyms | Lactose, anhydrous; Fast-flo; Lactose Galactinum |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 32 mg/mL (93.48 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.21 mL | 146.07 mL | 292.14 mL |
| 0.5 mM | 5.84 mL | 29.21 mL | 58.43 mL |
| 1 mM | 2.92 mL | 14.61 mL | 29.21 mL |
| 5 mM | 0.58 mL | 2.92 mL | 5.84 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
