Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Lanabecestat (AZD3293) is a potent, highly permeable, orally active and blood-brain barrier penetrating BACE1 inhibitor with a Ki of 0.4 nM. |
|---|
| Catalog Num | A12282 |
|---|---|
| Formula | C26H28N4O |
| Molecular Weight | 412.53 |
| CAS Number | 1383982-64-6 |
| SMILES | CC#CC1=CC(C2=CC([C@@]34N=C(C)C(N)=N4)=C(C[C@@]53CC[C@@H](OC)CC5)C=C2)=CN=C1 |
| Synonyms | AZD 3293, AZD-3293, AZD3293; LY3314814, LY-3314814, LY 3314814 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 80 mg/mL (193.92 mM) | |
| Water | Insoluble | ||
| Ethanol | 80 mg/mL (193.92 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.24 mL | 121.2 mL | 242.41 mL |
| 0.5 mM | 4.85 mL | 24.24 mL | 48.48 mL |
| 1 mM | 2.42 mL | 12.12 mL | 24.24 mL |
| 5 mM | 0.48 mL | 2.42 mL | 4.85 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
