Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Lawsone is a molluscacide from leaves of Lawsonia inermis L. topical sunscreening agent; powdered leaves of Lawsonia inermis(Lythraceae) used as brown hair dye. |
|---|
| Catalog Num | A17315 |
|---|---|
| Formula | C10H6O3 |
| Molecular Weight | 174.16 |
| CAS Number | 83-72-7 |
| SMILES | O=C1C(O)=CC(C2=C1C=CC=C2)=O |
| Synonyms | Lawsone |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 32 mg/mL (183.75 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 57.42 mL | 287.09 mL | 574.18 mL |
| 0.5 mM | 11.48 mL | 57.42 mL | 114.84 mL |
| 1 mM | 5.74 mL | 28.71 mL | 57.42 mL |
| 5 mM | 1.15 mL | 5.74 mL | 11.48 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
