Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Lercanidipine is a calcium channel blocker of the dihydropyridine class, which works by relaxing and opening the blood vessels allowing the blood to circulate more freely around the body. This lowers the blood pressure and allows the heart to work more efficiently. |
|---|
| Catalog Num | A17787 |
|---|---|
| Formula | C36H41N3O6 |
| Molecular Weight | 611.73 |
| CAS Number | 100427-26-7 |
| SMILES | CC1=C(C(OC)=O)C(C2=CC([N+]([O-])=O)=CC=C2)C(C(OC(C)(CN(CCC(C3=CC=CC=C3)C4=CC=CC=C4)C)C)=O)=C(C)N1 |
| Synonyms | Lercanidipine, Lercadip, Lerdip, Zanidip, REC-15-2375 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 48 mg/mL (78.46 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 16.35 mL | 81.74 mL | 163.47 mL |
| 0.5 mM | 3.27 mL | 16.35 mL | 32.69 mL |
| 1 mM | 1.63 mL | 8.17 mL | 16.35 mL |
| 5 mM | 0.33 mL | 1.63 mL | 3.27 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
