Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Lincomycin hydrochloride is a peptidyl transferase and protein translation inhibitor used to treat bacterial infections. It also inhibits growth of plasmodium. |
|---|
| Catalog Num | A17584 |
|---|---|
| Formula | C18H37ClN2O7S |
| Molecular Weight | 461.01 |
| CAS Number | 7179-49-9 |
| SMILES | CCC[C@@H]1C[C@@H](C(N[C@H]([C@H](O)C)[C@H]2O[C@H](SC)[C@H](O)[C@@H](O)[C@H]2O)=O)N(C)C1.Cl.O |
| Synonyms | Lincocin; Lincomix; Lincomycin HCl; NSC 70731; NSC70731; NSC- 70731; |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 86 mg/mL (186.55 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.69 mL | 108.46 mL | 216.92 mL |
| 0.5 mM | 4.34 mL | 21.69 mL | 43.38 mL |
| 1 mM | 2.17 mL | 10.85 mL | 21.69 mL |
| 5 mM | 0.43 mL | 2.17 mL | 4.34 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
