Loading distributor info...
| Description | Lobaplatin (D-19466) is a diastereometric mixture of platinum(II) complexes. Lobaplatin (D-19466) shows activity for a variety of tumour types and is a promising antitumour chemotherapeutic agent. |
|---|
| Catalog Num | A19203 |
|---|---|
| Formula | C9H16N2O3Pt |
| Molecular Weight | 395.32 |
| CAS Number | 135558-11-1 |
| SMILES | CC1[O-][Pt+2]2(NCC3C(CC3)CN2)[O-]C1=O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 1 mg/mL (2.51 mM) | |
| Water | 6 mg/mL (15.09 mM) | ||
| Ethanol | 3 mg/mL | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.3 mL | 126.48 mL | 252.96 mL |
| 0.5 mM | 5.06 mL | 25.3 mL | 50.59 mL |
| 1 mM | 2.53 mL | 12.65 mL | 25.3 mL |
| 5 mM | 0.51 mL | 2.53 mL | 5.06 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
