Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | LOC14 is a potent Protein disulfide isomerase (PDI) inhibitor with EC50 and Kd values of 500 nM and 62 nM, respectively. |
|---|
| Catalog Num | A20491 |
|---|---|
| Formula | C16H19N3O2S |
| Molecular Weight | 317.41 |
| CAS Number | 877963-94-5 |
| SMILES | O=C(C(C=CC=C1)=C1S2)N2CN3CCN(C(C4CC4)=O)CC3 |
| Synonyms | LOC 14, LOC-14 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 45 mg/mL (141.77 mM) | |
| Water | <1 mg/mL | ||
| Ethanol | 17 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.5 mL | 157.52 mL | 315.05 mL |
| 0.5 mM | 6.3 mL | 31.5 mL | 63.01 mL |
| 1 mM | 3.15 mL | 15.75 mL | 31.5 mL |
| 5 mM | 0.63 mL | 3.15 mL | 6.3 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
