Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | LX2343 is a BACE1 enzyme inhibitor with an IC50 value of 11.43±0.36 μM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A20288 |
|---|---|
| Formula | C22H19ClN2O6S |
| Molecular Weight | 474.91 |
| CAS Number | 333745-53-2 |
| SMILES | O=C(NC1=CC=C(OCO2)C2=C1)CN(C3=CC(Cl)=CC=C3OC)S(=O)(C4=CC=CC=C4)=O |
| Synonyms | LX 2343, LX-2343 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 92 mg/mL (193.71 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.06 mL | 105.28 mL | 210.57 mL |
| 0.5 mM | 4.21 mL | 21.06 mL | 42.11 mL |
| 1 mM | 2.11 mL | 10.53 mL | 21.06 mL |
| 5 mM | 0.42 mL | 2.11 mL | 4.21 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
