Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | LY2510924 is a potent and selective CXCR4 antagonist that blocks SDF-1 binding to CXCR4 with an IC50 of 0.079 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A22025 |
|---|---|
| Formula | C62H88N14O10 |
| Molecular Weight | 1189.45 |
| CAS Number | 1088715-84-7 |
| SMILES | O=C(NCC(N[C@H](CCC(N[C@H]1CC2=CC=CC=C2)=O)C(N[C@H](C(N)=O)CCCCNC(C)C)=O)=O)[C@@H](NC([C@@](NC([C@@H](NC([C@H](NC1=O)CC3=CC=C(O)C=C3)=O)CCCCNC(C)C)=O)([H])CCCNC(N)=N)=O)CC4=CC(C=CC=C5)=C5C=C4 |
| Synonyms | LY 2510924, LY-2510924 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 93 mg/mL (78.19 mM) | |
| Water | 93 mg/mL (78.19 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 8.41 mL | 42.04 mL | 84.07 mL |
| 0.5 mM | 1.68 mL | 8.41 mL | 16.81 mL |
| 1 mM | 0.84 mL | 4.2 mL | 8.41 mL |
| 5 mM | 0.17 mL | 0.84 mL | 1.68 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
