Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | LY317615 (Enzastaurin) is a potent and selective inhibitor of PKCβ with antiproliferative activity (IC50= ~6 nM). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10356 |
|---|---|
| Formula | C32H29N5O2 |
| Molecular Weight | 515.6 |
| CAS Number | 170364-57-5 |
| SMILES | CN1C=C(C2=CC=CC=C21)C3=C(C(=O)NC3=O)C4=CN(C5=CC=CC=C54)C6CCN(CC6)CC7=CC=CC=N7 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 29 mg/mL (56.24 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 15% Captisol | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.39 mL | 96.97 mL | 193.95 mL |
| 0.5 mM | 3.88 mL | 19.39 mL | 38.79 mL |
| 1 mM | 1.94 mL | 9.7 mL | 19.39 mL |
| 5 mM | 0.39 mL | 1.94 mL | 3.88 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
