Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | MC-Val-Cit-PAB is a cathepsin cleavable ADC linker that is used for making antibody-drug conjugate. FDA approved drugs such as brentuximab vedotin use this linker. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A20571 |
|---|---|
| Formula | C28H40N6O7 |
| Molecular Weight | 572.65 |
| CAS Number | 159857-80-4 |
| SMILES | CC(C)[C@@H](C(N[C@@H](CCCNC(N)=O)C(NC1=CC=C(CO)C=C1)=O)=O)NC(CCCCCN2C(C=CC2=O)=O)=O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 98 mg/mL (171.13 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.46 mL | 87.31 mL | 174.63 mL |
| 0.5 mM | 3.49 mL | 17.46 mL | 34.93 mL |
| 1 mM | 1.75 mL | 8.73 mL | 17.46 mL |
| 5 mM | 0.35 mL | 1.75 mL | 3.49 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
