Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Menaquinone-4 is a vitamin K, used as a hemostatic agent, and also a adjunctive therapy for the pain of osteoporosis. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17083 |
|---|---|
| Formula | C31H40O2 |
| Molecular Weight | 444.65 |
| CAS Number | 863-61-6 |
| SMILES | O=C1C(C/C=C(C)/CC/C=C(C)/CC/C=C(C)/CC/C=C(C)/C)=C(C)C(C2=CC=CC=C21)=O |
| Synonyms | Vitamin K2, Menaquinone K4, MK-4 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 84 mg/mL (188.9 mM) | |
| Ethanol | <1 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.49 mL | 112.45 mL | 224.9 mL |
| 0.5 mM | 4.5 mL | 22.49 mL | 44.98 mL |
| 1 mM | 2.25 mL | 11.24 mL | 22.49 mL |
| 5 mM | 0.45 mL | 2.25 mL | 4.5 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
