Loading distributor info...
| Description | Metyrosine is an inhibitor of the enzyme TYROSINE 3-MONOOXYGENASE. |
|---|
| Catalog Num | A18358 |
|---|---|
| Formula | C10H13NO3 |
| Molecular Weight | 195.21 |
| CAS Number | 672-87-7 |
| SMILES | O=C(O)[C@@](C)(N)CC1=CC=C(O)C=C1 |
| Synonyms | Demser, Metirosine, Racemetirosine, Metyrosine |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Insoluble | |
| Water | 2 mg/mL (10.24 mM) | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 51.23 mL | 256.13 mL | 512.27 mL |
| 0.5 mM | 10.25 mL | 51.23 mL | 102.45 mL |
| 1 mM | 5.12 mL | 25.61 mL | 51.23 mL |
| 5 mM | 1.02 mL | 5.12 mL | 10.25 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
