Loading distributor info...
| Description | Minodronic acid (YM-529) is an antagonist of purinergic P2X2/3 receptors involved in pain. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A21975 |
|---|---|
| Formula | C9H12N2O7P2 |
| Molecular Weight | 322.15 |
| CAS Number | 180064-38-4 |
| SMILES | OC(P(O)(O)=O)(P(O)(O)=O)CC1=CN=C2C=CC=CN21 |
| Synonyms | YM-529, YM529, YM529 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 0 mg/mL | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.04 mL | 155.21 mL | 310.41 mL |
| 0.5 mM | 6.21 mL | 31.04 mL | 62.08 mL |
| 1 mM | 3.1 mL | 15.52 mL | 31.04 mL |
| 5 mM | 0.62 mL | 3.1 mL | 6.21 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
