Signaling Pathway
GPX4 inhibitor
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | ML-210??the most potent compound in the nitroisoxazole series?? is a selective covalent inhibitor of glutathione peroxidase 4 (GPX4) by binding the selenocysteine residue. |
|---|
| Catalog Num | A20475 |
|---|---|
| Formula | C22H20Cl2N4O4 |
| Molecular Weight | 475.32 |
| CAS Number | 1360705-96-9 |
| SMILES | O=C(N1CCN(C(C2=CC=C(Cl)C=C2)C3=CC=C(Cl)C=C3)CC1)C4=NOC(C)=C4[N+]([O-])=O |
| Synonyms | CID 49766530; CID-49766530; CID49766530; ML 210; ML210 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 14 mg/mL (29.45 mM) | |
| Water | Insoluble | ||
| Ethanol | 4 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.04 mL | 105.19 mL | 210.38 mL |
| 0.5 mM | 4.21 mL | 21.04 mL | 42.08 mL |
| 1 mM | 2.1 mL | 10.52 mL | 21.04 mL |
| 5 mM | 0.42 mL | 2.1 mL | 4.21 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
