Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | MLN2238 is a potent reversible and specific β5 site of the 20S proteasome inhibitor with an IC50 value of 3.4 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10600 |
|---|---|
| Formula | C14H19BCl2N2O4 |
| Molecular Weight | 361 |
| CAS Number | 1072833-77-2 |
| SMILES | B([C@H](CC(C)C)NC(=O)CNC(=O)C1=C(C=CC(=C1)Cl)Cl)(O)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 64 mg/mL (177.26 mM) | |
| Water | Insoluble | ||
| Ethanol | 8 mg/mL (22.15 mM) | ||
| In vivo | 5% DMSO+45% PEG 300+ddH2O | 16 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.7 mL | 138.5 mL | 277.01 mL |
| 0.5 mM | 5.54 mL | 27.7 mL | 55.4 mL |
| 1 mM | 2.77 mL | 13.85 mL | 27.7 mL |
| 5 mM | 0.55 mL | 2.77 mL | 5.54 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
