Loading distributor info...
| Description | MS023 is a potent inihbitor of PRMTs 1,3,4,6,and 8 (IC50 = 30, 119, 83, 8, and 8 nM, respectively), which are responsible for asymmetric dimethylation of arginine residues. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12585 |
|---|---|
| Formula | C17H25N3O |
| Molecular Weight | 287.4 |
| CAS Number | 1831110-54-3 |
| SMILES | NCCN(C)CC1=CNC=C1C2=CC=C(OC(C)C)C=C2 |
| Synonyms | MS-023, MS 023 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 50 mg/mL (173.96 mM) | |
| Water | Insoluble | ||
| Ethanol | 50 mg/mL (173.96 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 34.79 mL | 173.97 mL | 347.95 mL |
| 0.5 mM | 6.96 mL | 34.79 mL | 69.59 mL |
| 1 mM | 3.48 mL | 17.4 mL | 34.79 mL |
| 5 mM | 0.7 mL | 3.48 mL | 6.96 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
