Loading distributor info...
| Description | N-Acetylornithine is an intermediate in the enzymatic biosynthesis of the amino acid L-arginine from L-glutamate. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A18847 |
|---|---|
| Formula | C7H14N2O3 |
| Molecular Weight | 174.2 |
| CAS Number | CAS: 6205-08-9 |
| SMILES | NCCC[C@@H](C(O)=O)NC(C)=O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Insoluble | |
| Water | 17 mg/mL (97.58 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 57.41 mL | 287.03 mL | 574.05 mL |
| 0.5 mM | 11.48 mL | 57.41 mL | 114.81 mL |
| 1 mM | 5.74 mL | 28.7 mL | 57.41 mL |
| 5 mM | 1.15 mL | 5.74 mL | 11.48 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
