Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | NAcM-OPT is an orally bioavailable cullin neddylation 1 (DCN1) inhibitor, which potently inhibits the DCN1-UBE2M interaction. |
|---|
| Catalog Num | A19646 |
|---|---|
| Formula | C23H29Cl2N3O |
| Molecular Weight | 434.4 |
| CAS Number | 2089293-61-6 |
| SMILES | O=C(NC1=CC=C(Cl)C(Cl)=C1)N(C2CCN(CCCC)CC2)CC3=CC=CC=C3 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 79 mg/mL (181.85 mM) | |
| Water | Insoluble | ||
| Ethanol | 79 mg/mL (181.85 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.02 mL | 115.1 mL | 230.2 mL |
| 0.5 mM | 4.6 mL | 23.02 mL | 46.04 mL |
| 1 mM | 2.3 mL | 11.51 mL | 23.02 mL |
| 5 mM | 0.46 mL | 2.3 mL | 4.6 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
