Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | Nifurtimox, an antiprotozoal agent, which is generally used for the treatment of infections with Trypanosoma cruzi, has been used in the therapy of neuroblastoma. Nifurtimox affects enzyme activity of lactate dehydrogenase (LDH). | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A18227 |
|---|---|
| Formula | C10H13N3O5S |
| Molecular Weight | 287.29 |
| CAS Number | 23256-30-6 |
| SMILES | O=[N+](C1=CC=C(/C=N/N2C(C)CS(CC2)(=O)=O)O1)[O-] |
| Synonyms | BAY 2502; Bayer 2502; Lampit. |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 54 mg/mL (187.96 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 34.81 mL | 174.04 mL | 348.08 mL |
| 0.5 mM | 6.96 mL | 34.81 mL | 69.62 mL |
| 1 mM | 3.48 mL | 17.4 mL | 34.81 mL |
| 5 mM | 0.7 mL | 3.48 mL | 6.96 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
