Signaling Pathway
Androgen receptor antagonist
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Nilutamide (Nilandron) is a non-steroidal anti-androgen drug proposed in the treatment of metastatic prostatic carcinoma. |
|---|
| Catalog Num | A21165 |
|---|---|
| Formula | C12H10F3N3O4 |
| Molecular Weight | 317.22 |
| CAS Number | 63612-50-0 |
| SMILES | O=C1N(C2=CC=C([N+]([O-])=O)C(C(F)(F)F)=C2)C(C(C)(C)N1)=O |
| Synonyms | Nilandron; RU 23908, RU23908, RU-23908 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 54 mg/mL (170.23 mM) | |
| Water | Insoluble | ||
| Ethanol | 54 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.52 mL | 157.62 mL | 315.24 mL |
| 0.5 mM | 6.3 mL | 31.52 mL | 63.05 mL |
| 1 mM | 3.15 mL | 15.76 mL | 31.52 mL |
| 5 mM | 0.63 mL | 3.15 mL | 6.3 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
