Loading distributor info...
| Description | NSC 185058 is an inhibitor of ATG4B, a cysteine protease that activates LC3B during the initiation of autophagy. |
|---|
| Catalog Num | A17121 |
|---|---|
| Formula | C11H9N3S |
| Molecular Weight | 215.3 |
| CAS Number | 39122-38-8 |
| SMILES | S=C(C1=NC=CC=C1)NC2=NC=CC=C2 |
| Synonyms | NSC185058, NSC-185058 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 43 mg/mL (199.74 mM) | |
| Water | Insoluble | ||
| Ethanol | 21 mg/mL (97.55 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 46.45 mL | 232.23 mL | 464.47 mL |
| 0.5 mM | 9.29 mL | 46.45 mL | 92.89 mL |
| 1 mM | 4.64 mL | 23.22 mL | 46.45 mL |
| 5 mM | 0.93 mL | 4.64 mL | 9.29 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
