Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | NSC23005 sodium is a novel and effective p18 inhibitor (ED50=5.21 nM) in promoting Hematopoietic stem cells (HSCs) expansion in both murine and human models. |
|---|
| Catalog Num | A20665 |
|---|---|
| Formula | C13H16NNaO4S |
| Molecular Weight | 305.33 |
| CAS Number | 1796596-46-7 |
| SMILES | O=C([O-])C1=CC=C(S(=O)(NC2CCCCC2)=O)C=C1.[Na+] |
| Synonyms | NSC 23005, NSC-23005 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 59 mg/mL (193.23 mM) | |
| Water | 59 mg/mL (193.23 mM) | ||
| Ethanol | 7 mg/mL (22.92 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.75 mL | 163.76 mL | 327.51 mL |
| 0.5 mM | 6.55 mL | 32.75 mL | 65.5 mL |
| 1 mM | 3.28 mL | 16.38 mL | 32.75 mL |
| 5 mM | 0.66 mL | 3.28 mL | 6.55 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
