Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | OC 000459 is a potent, oral and selective CRTH2 (also known as DP2) antagonist. |
|---|
| Catalog Num | A11946 |
|---|---|
| Formula | C21H17FN2O2 |
| Molecular Weight | 348.4 |
| CAS Number | 851723-84-7 |
| SMILES | CC1=C(C2=C(N1CC(=O)O)C=CC(=C2)F)CC3=NC4=CC=CC=C4C=C3 |
| Synonyms | OC000459, OC-000459 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 4 mg/mL (11.48 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.7 mL | 143.51 mL | 287.03 mL |
| 0.5 mM | 5.74 mL | 28.7 mL | 57.41 mL |
| 1 mM | 2.87 mL | 14.35 mL | 28.7 mL |
| 5 mM | 0.57 mL | 2.87 mL | 5.74 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
