Signaling Pathway
5-HT3 receptor antagonist
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Ondansetron hydrochloride is a serotonin 5-HT3 receptor antagonist. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17410 |
|---|---|
| Formula | C18H20ClN3O |
| Molecular Weight | 329.828 |
| CAS Number | 103639-04-9 |
| SMILES | O=C1C(CN2C=CN=C2C)CCC(N3C)=C1C4=C3C=CC=C4.[H]Cl |
| Synonyms | Ondansetron hydrochloride |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 69 mg/mL (188.6 mM) | |
| Water | Warmed: 69 mg/mL (188.6 mM) | ||
| Ethanol | Warmed: 38 mg/mL (103.86 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 30.32 mL | 151.59 mL | 303.19 mL |
| 0.5 mM | 6.06 mL | 30.32 mL | 60.64 mL |
| 1 mM | 3.03 mL | 15.16 mL | 30.32 mL |
| 5 mM | 0.61 mL | 3.03 mL | 6.06 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
