Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | ONX 0914 is an immunoproteasome inhibitor with potential treatment applications in autoimmune disorders, such as rheumatoid arthritis, inflammatory bowel disease and lupus. ONX 0914 was designed to be a potent inhibitor of the immunoproteasome with minimal cross-reactivity for the constitutive proteasome. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12653 |
|---|---|
| Formula | C31H40N4O7 |
| Molecular Weight | 580.67 |
| CAS Number | 960374-59-8 |
| SMILES | C[C@@H](C(=O)N[C@@H](CC1=CC=C(C=C1)OC)C(=O)N[C@@H](CC2=CC=CC=C2)C(=O)[C@]3(CO3)C)NC(=O)CN4CCOCC4 |
| Synonyms | ONX0914, ONX 0914, PR-957 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 87 mg/mL (149.82 mM) | |
| Water | Insoluble | ||
| Ethanol | 87 mg/mL (149.82 mM) | ||
| In vivo | 2% DMSO+castor oil | 9 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.22 mL | 86.11 mL | 172.21 mL |
| 0.5 mM | 3.44 mL | 17.22 mL | 34.44 mL |
| 1 mM | 1.72 mL | 8.61 mL | 17.22 mL |
| 5 mM | 0.34 mL | 1.72 mL | 3.44 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
