Loading distributor info...
| Description | Paris saponin VII (Chonglou Saponin VII) is a steroidal saponin isolated from the roots and rhizomes of Trillium tschonoskii Maxim. Paris saponin VII induces a robust autophagy in K562/ADR cells and provides a biochemical basis in the treatment of leukemia. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A18382 |
|---|---|
| Formula | C51H82O21 |
| Molecular Weight | 1031.18 |
| CAS Number | 68124-04-9 |
| SMILES | C[C@@H]1CC[C@@]2([C@H]([C@]3([C@@H](O2)C[C@@H]4[C@@]3(CC[C@H]5[C@H]4CC=C6[C@@]5(CC[C@@H](C6)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O[C@H]8[C@@H]([C@@H]([C@H]([C@@H](O8)C)O[C@H]9[C@@H]([C@@H]([C@H]([C@@H](O9)C)O)O)O)O)O)O)O[C@H]2[C@@H]([C@@H]([C@H]([C@@H](O2)C)O)O)O)C)C)O)C)OC1 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 86 mg/mL (83.39 mM) | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 9.7 mL | 48.49 mL | 96.98 mL |
| 0.5 mM | 1.94 mL | 9.7 mL | 19.4 mL |
| 1 mM | 0.97 mL | 4.85 mL | 9.7 mL |
| 5 mM | 0.19 mL | 0.97 mL | 1.94 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
