Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | PD184352 (CI-1040) is an ATP non-competitive MEK1/2 inhibitor with IC50 of 17 nM in cell-based assays, 100-fold more selective for MEK1/2 than MEK5. Phase 2. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10212 |
|---|---|
| Formula | C17H14ClF2IN2O2 |
| Molecular Weight | 478.7 |
| CAS Number | 212631-79-3 |
| SMILES | C1CC1CONC(=O)C2=C(C(=C(C=C2)F)F)NC3=C(C=C(C=C3)I)Cl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 92 mg/mL (192.19 mM) | |
| Water | Insoluble | ||
| Ethanol | 13 mg/mL (27.15 mM) | ||
| In vivo | 30% PEG400+0.5% Tween80+5% propylene glycol, pH 9 | 9 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.89 mL | 104.45 mL | 208.9 mL |
| 0.5 mM | 4.18 mL | 20.89 mL | 41.78 mL |
| 1 mM | 2.09 mL | 10.44 mL | 20.89 mL |
| 5 mM | 0.42 mL | 2.09 mL | 4.18 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
