Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | PHA-767491 hydrochloride is a dual Cdc7/Cdk9 inhibitor, with IC50s of 10 nM and 34 nM, respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A21395 |
|---|---|
| Formula | C12H12ClN3O |
| Molecular Weight | 249.7 |
| CAS Number | 942425-68-5 |
| SMILES | O=C1C2=C(NC(C3=CC=NC=C3)=C2)CCN1.[H]Cl |
| Synonyms | PHA767491, PHA 767491, CAY-10572 hydrochloride, CAY10572, CAY 10572 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 24 mg/mL (96.11 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 5% DMSO+30% PEG 300+2% Tween 80+ddH2O | 1 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 40.05 mL | 200.24 mL | 400.48 mL |
| 0.5 mM | 8.01 mL | 40.05 mL | 80.1 mL |
| 1 mM | 4 mL | 20.02 mL | 40.05 mL |
| 5 mM | 0.8 mL | 4 mL | 8.01 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
