Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Phenylbutazone is a compound of research interest as an anti-inflammatory and anti-proliferative agent. |
|---|
| Catalog Num | A10720 |
|---|---|
| Formula | C19H20N2O2 |
| Molecular Weight | 308.38 |
| CAS Number | 50-33-9 |
| SMILES | CCCCC1C(=O)N(N(C1=O)C2=CC=CC=C2)C3=CC=CC=C3 |
| Synonyms | Bute |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 55 mg/mL (178.35 mM) | |
| Water | Insoluble | ||
| Ethanol | 55 mg/mL (178.35 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.43 mL | 162.14 mL | 324.28 mL |
| 0.5 mM | 6.49 mL | 32.43 mL | 64.86 mL |
| 1 mM | 3.24 mL | 16.21 mL | 32.43 mL |
| 5 mM | 0.65 mL | 3.24 mL | 6.49 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
