Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | PIM447 is a novel pan-PIM kinase inhibitor with Ki values of 6 pM, 18 pM, 9 pM for PIM1, PIM2, PIM3 respectively. It also inhibits GSK3β, PKN1, and PKCτ, but at a significantly lower potency with IC50 between 1 and 5 μM (>105-fold differential relative to the Ki on PIMs). | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A16807 |
|---|---|
| Formula | C24H23F3N4O |
| Molecular Weight | 440.47 |
| CAS Number | 1210608-43-7 |
| SMILES | O=C(NC1=C([C@H]2C[C@@H](N)C[C@@H](C)C2)C=CN=C1)C3=NC(C4=C(F)C=CC=C4F)=C(F)C=C3 |
| Synonyms | LGH-447; LGH 447; LGH447; PIM447; PIM-447; PIM 447; LGH447 free base |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 76 mg/mL (159.35 mM) | |
| Water | Insoluble | ||
| Ethanol | 76 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.7 mL | 113.52 mL | 227.03 mL |
| 0.5 mM | 4.54 mL | 22.7 mL | 45.41 mL |
| 1 mM | 2.27 mL | 11.35 mL | 22.7 mL |
| 5 mM | 0.45 mL | 2.27 mL | 4.54 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
