Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Prostaglandin E2 is a hormone-like substance that participate in a wide range of body functions such as the contraction and relaxation of smooth muscle, the dilation and constriction of blood vessels, control of blood pressure, and modulation of inflammation. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11903 |
|---|---|
| Formula | C20H32O5 |
| Molecular Weight | 352.47 |
| CAS Number | 363-24-6 |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@H](C(C[C@H]1O)=O)C/C=C\CCCC(O)=O |
| Synonyms | Dinoprostone |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 62 mg/mL (175.89 mM) | |
| Water | 35 mg/mL (99.3 mM) | ||
| Ethanol | 62 mg/mL (175.89 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.37 mL | 141.86 mL | 283.71 mL |
| 0.5 mM | 5.67 mL | 28.37 mL | 56.74 mL |
| 1 mM | 2.84 mL | 14.19 mL | 28.37 mL |
| 5 mM | 0.57 mL | 2.84 mL | 5.67 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
