Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | PS-1145 is a highly specific IKB kinase (IKK) inhibitor that efficiently inhibits both basal and induced NF-kB activity in PC cells. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12789 |
|---|---|
| Formula | C17H11ClN4O |
| Molecular Weight | 322.75 |
| CAS Number | 431898-65-6 |
| SMILES | C1=CC(=CN=C1)C(=O)NC2=C3C(=CC(=C2)Cl)C4=C(N3)C=NC=C4 |
| Synonyms | PS1145,PS 1145 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 61 mg/mL (189 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 2 mg/mL (6.19 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 30.98 mL | 154.92 mL | 309.84 mL |
| 0.5 mM | 6.2 mL | 30.98 mL | 61.97 mL |
| 1 mM | 3.1 mL | 15.49 mL | 30.98 mL |
| 5 mM | 0.62 mL | 3.1 mL | 6.2 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
