Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | PTP1B-IN-2 is a potent protein tyrosine phosphatase 1B (PTP1B) inhibitor with an IC50 of 50 nM. |
|---|
| Catalog Num | A20428 |
|---|---|
| Formula | C34H36N2O9S2 |
| Molecular Weight | 680.79 |
| CAS Number | 1919853-46-5 |
| SMILES | O=S(N(C1=CC(C(OC)=O)=C(OCC2=CC=C(C)C=C2)C=C1)CC3=CC=C(N(S(C)(=O)=O)CC(OC)=O)C=C3)(CC4=CC=CC=C4)=O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 98 mg/mL (143.94 mM) | |
| Water | <1 mg/mL | ||
| Ethanol | <1 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 14.69 mL | 73.44 mL | 146.89 mL |
| 0.5 mM | 2.94 mL | 14.69 mL | 29.38 mL |
| 1 mM | 1.47 mL | 7.34 mL | 14.69 mL |
| 5 mM | 0.29 mL | 1.47 mL | 2.94 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
