Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | Ranolazine dihydrochloride (CVT 303 dihydrochloride) is an anti-angina drug that achieves its effects by inhibiting the late phase of inward sodium current (INa and IKr with IC50 values of 6 μM and 12 μM, respectively) without affecting heart rate or blood pressure (BP). |
|---|
| Catalog Num | A10781 |
|---|---|
| Formula | C24H35Cl2N3O4 |
| Molecular Weight | 500.46 |
| CAS Number | 95635-56-6 |
| SMILES | O=C(NC1=C(C)C=CC=C1C)CN2CCN(CC(O)COC3=CC=CC=C3OC)CC2.[H]Cl.[H]Cl |
| Synonyms | CVT 303 dihydrochloride, CVT-303, CVT303; RS 43285, RS43285, RS-43285 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 90 mg/mL (179.83 mM) | |
| Water | 90 mg/mL (179.83 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.98 mL | 99.91 mL | 199.82 mL |
| 0.5 mM | 4 mL | 19.98 mL | 39.96 mL |
| 1 mM | 2 mL | 9.99 mL | 19.98 mL |
| 5 mM | 0.4 mL | 2 mL | 4 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
